C23H23N5OS2 — CID 78107858
5-[[3-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]benzimidazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 78107858) has the molecular formula C23H23N5OS2 and a molecular weight of 449.61 g/mol. Its IUPAC name is 5-[[3-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]benzimidazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]benzimidazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 78107858 |
| Molecular Formula | C23H23N5OS2 |
| Molecular Weight | 449.61 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 5-[[3-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]benzimidazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN1CCCN(c2ccc(-n3cnc4ccc(C=C5SC(=S)NC5=O)cc43)cc2)CC1 |
| InChI | InChI=1S/C23H23N5OS2/c1-26-9-2-10-27(12-11-26)17-4-6-18(7-5-17)28-15-24-19-8-3-16(13-20(19)28)14-21-22(29)25-23(30)31-21/h3-8,13-15H,2,9-12H2,1H3,(H,25,29,30) |
| InChIKey | YAGVQOVWZVUDQN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.61 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|