C22H18F2N4OS2 — CID 78107754
5-[[3-[4-(4,4-difluoropiperidin-1-yl)phenyl]benzimidazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 78107754) has the molecular formula C22H18F2N4OS2 and a molecular weight of 456.54 g/mol. Its IUPAC name is 5-[[3-[4-(4,4-difluoropiperidin-1-yl)phenyl]benzimidazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3-[4-(4,4-difluoropiperidin-1-yl)phenyl]benzimidazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 78107754 |
| Molecular Formula | C22H18F2N4OS2 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 5-[[3-[4-(4,4-difluoropiperidin-1-yl)phenyl]benzimidazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)SC1=Cc1ccc2ncn(-c3ccc(N4CCC(F)(F)CC4)cc3)c2c1 |
| InChI | InChI=1S/C22H18F2N4OS2/c23-22(24)7-9-27(10-8-22)15-2-4-16(5-3-15)28-13-25-17-6-1-14(11-18(17)28)12-19-20(29)26-21(30)31-19/h1-6,11-13H,7-10H2,(H,26,29,30) |
| InChIKey | LFXLATOYEFYOMT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|