C27H18N4O4S2 — CID 78107752
2-[2-[4-[6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzimidazol-1-yl]phenoxy]ethyl]isoindole-1,3-dione (PubChem CID 78107752) has the molecular formula C27H18N4O4S2 and a molecular weight of 526.60 g/mol. Its IUPAC name is 2-[2-[4-[6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzimidazol-1-yl]phenoxy]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-[6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzimidazol-1-yl]phenoxy]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 78107752 |
| Molecular Formula | C27H18N4O4S2 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | 2-[2-[4-[6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzimidazol-1-yl]phenoxy]ethyl]isoindole-1,3-dione |
| SMILES | O=C1NC(=S)SC1=Cc1ccc2ncn(-c3ccc(OCCN4C(=O)c5ccccc5C4=O)cc3)c2c1 |
| InChI | InChI=1S/C27H18N4O4S2/c32-24-23(37-27(36)29-24)14-16-5-10-21-22(13-16)31(15-28-21)17-6-8-18(9-7-17)35-12-11-30-25(33)19-3-1-2-4-20(19)26(30)34/h1-10,13-15H,11-12H2,(H,29,32,36) |
| InChIKey | QSWWAJHVWBCIEC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|