C22H20N4OS3 — CID 78107632
5-[[3-[4-(4-methylpiperazin-1-yl)phenyl]-1,2-benzothiazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 78107632) has the molecular formula C22H20N4OS3 and a molecular weight of 452.63 g/mol. Its IUPAC name is 5-[[3-[4-(4-methylpiperazin-1-yl)phenyl]-1,2-benzothiazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3-[4-(4-methylpiperazin-1-yl)phenyl]-1,2-benzothiazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 78107632 |
| Molecular Formula | C22H20N4OS3 |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 5-[[3-[4-(4-methylpiperazin-1-yl)phenyl]-1,2-benzothiazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN1CCN(c2ccc(-c3nsc4ccc(C=C5SC(=S)NC5=O)cc34)cc2)CC1 |
| InChI | InChI=1S/C22H20N4OS3/c1-25-8-10-26(11-9-25)16-5-3-15(4-6-16)20-17-12-14(2-7-18(17)30-24-20)13-19-21(27)23-22(28)29-19/h2-7,12-13H,8-11H2,1H3,(H,23,27,28) |
| InChIKey | OXESCPHHLWVQTB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|