C24H20N6O2S2 — CID 90465903
(5Z)-5-[[4-[2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl]quinazolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 90465903) has the molecular formula C24H20N6O2S2 and a molecular weight of 488.60 g/mol. Its IUPAC name is (5Z)-5-[[4-[2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl]quinazolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl]quinazolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 90465903 |
| Molecular Formula | C24H20N6O2S2 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | (5Z)-5-[[4-[2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl]quinazolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN1CCN(c2nc3ccc(-c4ncnc5ccc(/C=C6\SC(=O)NC6=O)cc45)cc3s2)CC1 |
| InChI | InChI=1S/C24H20N6O2S2/c1-29-6-8-30(9-7-29)23-27-18-5-3-15(12-19(18)33-23)21-16-10-14(2-4-17(16)25-13-26-21)11-20-22(31)28-24(32)34-20/h2-5,10-13H,6-9H2,1H3,(H,28,31,32)/b20-11- |
| InChIKey | QVPJDEJIGQYRGD-JAIQZWGSSA-N |
| XLogP | 3.98 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|