C20H18N6O2S2 — CID 90467243
(5Z)-5-[[4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-5-yl]quinazolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 90467243) has the molecular formula C20H18N6O2S2 and a molecular weight of 438.54 g/mol. Its IUPAC name is (5Z)-5-[[4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-5-yl]quinazolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-5-yl]quinazolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 90467243 |
| Molecular Formula | C20H18N6O2S2 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | (5Z)-5-[[4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-5-yl]quinazolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN1CCN(c2ncc(-c3ncnc4ccc(/C=C5\SC(=O)NC5=O)cc34)s2)CC1 |
| InChI | InChI=1S/C20H18N6O2S2/c1-25-4-6-26(7-5-25)19-21-10-16(29-19)17-13-8-12(2-3-14(13)22-11-23-17)9-15-18(27)24-20(28)30-15/h2-3,8-11H,4-7H2,1H3,(H,24,27,28)/b15-9- |
| InChIKey | NMINGBRUSNHAPC-DHDCSXOGSA-N |
| XLogP | 2.83 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|