C20H20ClN5O2S — CID 75304016
5-[[4-chloro-3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 75304016) has the molecular formula C20H20ClN5O2S and a molecular weight of 429.93 g/mol. Its IUPAC name is 5-[[4-chloro-3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-chloro-3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 75304016 |
| Molecular Formula | C20H20ClN5O2S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 5-[[4-chloro-3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN1CCCN(c2cncc(-c3cc(C=C4SC(=O)NC4=O)ccc3Cl)n2)CC1 |
| InChI | InChI=1S/C20H20ClN5O2S/c1-25-5-2-6-26(8-7-25)18-12-22-11-16(23-18)14-9-13(3-4-15(14)21)10-17-19(27)24-20(28)29-17/h3-4,9-12H,2,5-8H2,1H3,(H,24,27,28) |
| InChIKey | SFNIRTVRUQQUFY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|