C23H22N4O3S — CID 118090634
(5E)-5-[[7-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118090634) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is (5E)-5-[[7-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[7-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118090634 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (5E)-5-[[7-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN1CCN(Cc2ccc(-c3cncc4cc(/C=C5/SC(=O)NC5=O)oc34)cc2)CC1 |
| InChI | InChI=1S/C23H22N4O3S/c1-26-6-8-27(9-7-26)14-15-2-4-16(5-3-15)19-13-24-12-17-10-18(30-21(17)19)11-20-22(28)25-23(29)31-20/h2-5,10-13H,6-9,14H2,1H3,(H,25,28,29)/b20-11+ |
| InChIKey | HPMGVMMAXOXOPU-RGVLZGJSSA-N |
| XLogP | 3.57 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|