C17H9ClN2O4S — CID 154167204
5-[[7-(3-chloro-4-hydroxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 154167204) has the molecular formula C17H9ClN2O4S and a molecular weight of 372.79 g/mol. Its IUPAC name is 5-[[7-(3-chloro-4-hydroxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[7-(3-chloro-4-hydroxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 154167204 |
| Molecular Formula | C17H9ClN2O4S |
| Molecular Weight | 372.79 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 5-[[7-(3-chloro-4-hydroxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2cc3cncc(-c4ccc(O)c(Cl)c4)c3o2)S1 |
| InChI | InChI=1S/C17H9ClN2O4S/c18-12-4-8(1-2-13(12)21)11-7-19-6-9-3-10(24-15(9)11)5-14-16(22)20-17(23)25-14/h1-7,21H,(H,20,22,23) |
| InChIKey | VFOYCIHEWSMWPZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.79 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|