C17H11N3O3S — CID 118089221
(5E)-5-[[7-(4-aminophenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118089221) has the molecular formula C17H11N3O3S and a molecular weight of 337.36 g/mol. Its IUPAC name is (5E)-5-[[7-(4-aminophenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[7-(4-aminophenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118089221 |
| Molecular Formula | C17H11N3O3S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | (5E)-5-[[7-(4-aminophenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Nc1ccc(-c2cncc3cc(/C=C4/SC(=O)NC4=O)oc23)cc1 |
| InChI | InChI=1S/C17H11N3O3S/c18-11-3-1-9(2-4-11)13-8-19-7-10-5-12(23-15(10)13)6-14-16(21)20-17(22)24-14/h1-8H,18H2,(H,20,21,22)/b14-6+ |
| InChIKey | ZOZNSSXLPLOKIM-MKMNVTDBSA-N |
| XLogP | 3.40 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|