C21H19N3O5S2 — CID 140751541
N-tert-butyl-4-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzenesulfonamide (PubChem CID 140751541) has the molecular formula C21H19N3O5S2 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-tert-butyl-4-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzenesulfonamide.
| Compound Name | N-tert-butyl-4-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 140751541 |
| Molecular Formula | C21H19N3O5S2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | N-tert-butyl-4-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(-c2cncc3cc(C=C4SC(=O)NC4=O)oc23)cc1 |
| InChI | InChI=1S/C21H19N3O5S2/c1-21(2,3)24-31(27,28)15-6-4-12(5-7-15)16-11-22-10-13-8-14(29-18(13)16)9-17-19(25)23-20(26)30-17/h4-11,24H,1-3H3,(H,23,25,26) |
| InChIKey | OPXBBYCVZDFBED-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|