C19H15N3O6S2 — CID 118089836
4-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 118089836) has the molecular formula C19H15N3O6S2 and a molecular weight of 445.48 g/mol. Its IUPAC name is 4-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 4-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 118089836 |
| Molecular Formula | C19H15N3O6S2 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 4-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | O=C1NC(=O)/C(=C/c2cc3cncc(-c4ccc(S(=O)(=O)NCCO)cc4)c3o2)S1 |
| InChI | InChI=1S/C19H15N3O6S2/c23-6-5-21-30(26,27)14-3-1-11(2-4-14)15-10-20-9-12-7-13(28-17(12)15)8-16-18(24)22-19(25)29-16/h1-4,7-10,21,23H,5-6H2,(H,22,24,25)/b16-8- |
| InChIKey | LJWJVFYBRMYHLD-PXNMLYILSA-N |
| XLogP | 2.09 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|