C24H24N4O5S2 — CID 118090236
(5Z)-5-[[7-[4-(4-propylpiperazin-1-yl)sulfonylphenyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118090236) has the molecular formula C24H24N4O5S2 and a molecular weight of 512.61 g/mol. Its IUPAC name is (5Z)-5-[[7-[4-(4-propylpiperazin-1-yl)sulfonylphenyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[7-[4-(4-propylpiperazin-1-yl)sulfonylphenyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118090236 |
| Molecular Formula | C24H24N4O5S2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | (5Z)-5-[[7-[4-(4-propylpiperazin-1-yl)sulfonylphenyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCN1CCN(S(=O)(=O)c2ccc(-c3cncc4cc(/C=C5\SC(=O)NC5=O)oc34)cc2)CC1 |
| InChI | InChI=1S/C24H24N4O5S2/c1-2-7-27-8-10-28(11-9-27)35(31,32)19-5-3-16(4-6-19)20-15-25-14-17-12-18(33-22(17)20)13-21-23(29)26-24(30)34-21/h3-6,12-15H,2,7-11H2,1H3,(H,26,29,30)/b21-13- |
| InChIKey | MSZMPJQQOKZJIA-BKUYFWCQSA-N |
| XLogP | 3.54 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|