C18H13N3O5S2 — CID 118090255
N-[3-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]phenyl]methanesulfonamide (PubChem CID 118090255) has the molecular formula C18H13N3O5S2 and a molecular weight of 415.45 g/mol. Its IUPAC name is N-[3-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 118090255 |
| Molecular Formula | C18H13N3O5S2 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | N-[3-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(-c2cncc3cc(/C=C4/SC(=O)NC4=O)oc23)c1 |
| InChI | InChI=1S/C18H13N3O5S2/c1-28(24,25)21-12-4-2-3-10(5-12)14-9-19-8-11-6-13(26-16(11)14)7-15-17(22)20-18(23)27-15/h2-9,21H,1H3,(H,20,22,23)/b15-7+ |
| InChIKey | QQOPNPKNHGGOJK-VIZOYTHASA-N |
| XLogP | 3.19 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|