C18H9N3O3S — CID 154155699
3-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzonitrile (PubChem CID 154155699) has the molecular formula C18H9N3O3S and a molecular weight of 347.36 g/mol. Its IUPAC name is 3-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzonitrile.
| Compound Name | 3-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzonitrile |
|---|---|
| PubChem CID | 154155699 |
| Molecular Formula | C18H9N3O3S |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 3-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cncc3cc(C=C4SC(=O)NC4=O)oc23)c1 |
| InChI | InChI=1S/C18H9N3O3S/c19-7-10-2-1-3-11(4-10)14-9-20-8-12-5-13(24-16(12)14)6-15-17(22)21-18(23)25-15/h1-6,8-9H,(H,21,22,23) |
| InChIKey | WCOGMARAHDEXAL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|