C20H14N2O5S — CID 154109120
ethyl 3-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzoate (PubChem CID 154109120) has the molecular formula C20H14N2O5S and a molecular weight of 394.41 g/mol. Its IUPAC name is ethyl 3-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzoate.
| Compound Name | ethyl 3-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzoate |
|---|---|
| PubChem CID | 154109120 |
| Molecular Formula | C20H14N2O5S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | ethyl 3-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2cncc3cc(C=C4SC(=O)NC4=O)oc23)c1 |
| InChI | InChI=1S/C20H14N2O5S/c1-2-26-19(24)12-5-3-4-11(6-12)15-10-21-9-13-7-14(27-17(13)15)8-16-18(23)22-20(25)28-16/h3-10H,2H2,1H3,(H,22,23,25) |
| InChIKey | DXOWTNQMAXPHML-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|