C18H12N2O3S2 — CID 154203928
5-[[7-(3-methylsulfanylphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 154203928) has the molecular formula C18H12N2O3S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 5-[[7-(3-methylsulfanylphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[7-(3-methylsulfanylphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 154203928 |
| Molecular Formula | C18H12N2O3S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 5-[[7-(3-methylsulfanylphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CSc1cccc(-c2cncc3cc(C=C4SC(=O)NC4=O)oc23)c1 |
| InChI | InChI=1S/C18H12N2O3S2/c1-24-13-4-2-3-10(6-13)14-9-19-8-11-5-12(23-16(11)14)7-15-17(21)20-18(22)25-15/h2-9H,1H3,(H,20,21,22) |
| InChIKey | LBAJUIPUKHQTSV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|