C22H13N3O4S — CID 154114414
5-[[7-(3-pyridin-4-yloxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 154114414) has the molecular formula C22H13N3O4S and a molecular weight of 415.43 g/mol. Its IUPAC name is 5-[[7-(3-pyridin-4-yloxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[7-(3-pyridin-4-yloxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 154114414 |
| Molecular Formula | C22H13N3O4S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 5-[[7-(3-pyridin-4-yloxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2cc3cncc(-c4cccc(Oc5ccncc5)c4)c3o2)S1 |
| InChI | InChI=1S/C22H13N3O4S/c26-21-19(30-22(27)25-21)10-17-9-14-11-24-12-18(20(14)29-17)13-2-1-3-16(8-13)28-15-4-6-23-7-5-15/h1-12H,(H,25,26,27) |
| InChIKey | OYHUDALWNAUWKT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|