C24H16N2O4S — CID 118090697
(5E)-5-[[7-(4-phenylmethoxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118090697) has the molecular formula C24H16N2O4S and a molecular weight of 428.47 g/mol. Its IUPAC name is (5E)-5-[[7-(4-phenylmethoxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[7-(4-phenylmethoxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118090697 |
| Molecular Formula | C24H16N2O4S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | (5E)-5-[[7-(4-phenylmethoxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2cc3cncc(-c4ccc(OCc5ccccc5)cc4)c3o2)S1 |
| InChI | InChI=1S/C24H16N2O4S/c27-23-21(31-24(28)26-23)11-19-10-17-12-25-13-20(22(17)30-19)16-6-8-18(9-7-16)29-14-15-4-2-1-3-5-15/h1-13H,14H2,(H,26,27,28)/b21-11+ |
| InChIKey | BLCLITBCAZZNDQ-SRZZPIQSSA-N |
| XLogP | 5.40 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|