C17H11N3O5S2 — CID 118089440
4-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzenesulfonamide (PubChem CID 118089440) has the molecular formula C17H11N3O5S2 and a molecular weight of 401.43 g/mol. Its IUPAC name is 4-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzenesulfonamide.
| Compound Name | 4-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 118089440 |
| Molecular Formula | C17H11N3O5S2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | 4-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2cncc3cc(/C=C4/SC(=O)NC4=O)oc23)cc1 |
| InChI | InChI=1S/C17H11N3O5S2/c18-27(23,24)12-3-1-9(2-4-12)13-8-19-7-10-5-11(25-15(10)13)6-14-16(21)20-17(22)26-14/h1-8H,(H2,18,23,24)(H,20,21,22)/b14-6+ |
| InChIKey | KRXMCPXITNLPAE-MKMNVTDBSA-N |
| XLogP | 2.47 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|