C15H10N4O3S — CID 118090108
(5E)-5-[[7-(1-methylpyrazol-4-yl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118090108) has the molecular formula C15H10N4O3S and a molecular weight of 326.34 g/mol. Its IUPAC name is (5E)-5-[[7-(1-methylpyrazol-4-yl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[7-(1-methylpyrazol-4-yl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118090108 |
| Molecular Formula | C15H10N4O3S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (5E)-5-[[7-(1-methylpyrazol-4-yl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cn1cc(-c2cncc3cc(/C=C4/SC(=O)NC4=O)oc23)cn1 |
| InChI | InChI=1S/C15H10N4O3S/c1-19-7-9(5-17-19)11-6-16-4-8-2-10(22-13(8)11)3-12-14(20)18-15(21)23-12/h2-7H,1H3,(H,18,20,21)/b12-3+ |
| InChIKey | MHUOOZDZPLKVON-KGVSQERTSA-N |
| XLogP | 2.55 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|