C19H13Cl2N3O5S2 — CID 118089390
2,6-dichloro-4-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 118089390) has the molecular formula C19H13Cl2N3O5S2 and a molecular weight of 498.37 g/mol. Its IUPAC name is 2,6-dichloro-4-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2,6-dichloro-4-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 118089390 |
| Molecular Formula | C19H13Cl2N3O5S2 |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 496.97 |
| IUPAC Name | 2,6-dichloro-4-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1c(Cl)cc(-c2cncc3cc(/C=C4\SC(=O)NC4=O)oc23)cc1Cl |
| InChI | InChI=1S/C19H13Cl2N3O5S2/c1-24(2)31(27,28)17-13(20)4-9(5-14(17)21)12-8-22-7-10-3-11(29-16(10)12)6-15-18(25)23-19(26)30-15/h3-8H,1-2H3,(H,23,25,26)/b15-6- |
| InChIKey | PRPIYSHMWKHLEG-UUASQNMZSA-N |
| XLogP | 4.38 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|