C18H10Cl2N2O4S — CID 118089721
(5Z)-5-[[7-(3,5-dichloro-4-methoxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118089721) has the molecular formula C18H10Cl2N2O4S and a molecular weight of 421.26 g/mol. Its IUPAC name is (5Z)-5-[[7-(3,5-dichloro-4-methoxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[7-(3,5-dichloro-4-methoxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118089721 |
| Molecular Formula | C18H10Cl2N2O4S |
| Molecular Weight | 421.26 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | (5Z)-5-[[7-(3,5-dichloro-4-methoxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1c(Cl)cc(-c2cncc3cc(/C=C4\SC(=O)NC4=O)oc23)cc1Cl |
| InChI | InChI=1S/C18H10Cl2N2O4S/c1-25-16-12(19)3-8(4-13(16)20)11-7-21-6-9-2-10(26-15(9)11)5-14-17(23)22-18(24)27-14/h2-7H,1H3,(H,22,23,24)/b14-5- |
| InChIKey | KKRYTIFACRHBHR-RZNTYIFUSA-N |
| XLogP | 5.13 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.26 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|