C19H11N3O4S — CID 118090415
5-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-2-methoxybenzonitrile (PubChem CID 118090415) has the molecular formula C19H11N3O4S and a molecular weight of 377.38 g/mol. Its IUPAC name is 5-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-2-methoxybenzonitrile.
| Compound Name | 5-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 118090415 |
| Molecular Formula | C19H11N3O4S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 5-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-2-methoxybenzonitrile |
| SMILES | COc1ccc(-c2cncc3cc(/C=C4\SC(=O)NC4=O)oc23)cc1C#N |
| InChI | InChI=1S/C19H11N3O4S/c1-25-15-3-2-10(4-11(15)7-20)14-9-21-8-12-5-13(26-17(12)14)6-16-18(23)22-19(24)27-16/h2-6,8-9H,1H3,(H,22,23,24)/b16-6- |
| InChIKey | KLMYEJMRCGTGLK-SOFYXZRVSA-N |
| XLogP | 3.70 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|