C24H13N3O4S — CID 118090110
2-[3-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]phenoxy]benzonitrile (PubChem CID 118090110) has the molecular formula C24H13N3O4S and a molecular weight of 439.45 g/mol. Its IUPAC name is 2-[3-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]phenoxy]benzonitrile.
| Compound Name | 2-[3-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]phenoxy]benzonitrile |
|---|---|
| PubChem CID | 118090110 |
| Molecular Formula | C24H13N3O4S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 2-[3-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]phenoxy]benzonitrile |
| SMILES | N#Cc1ccccc1Oc1cccc(-c2cncc3cc(/C=C4\SC(=O)NC4=O)oc23)c1 |
| InChI | InChI=1S/C24H13N3O4S/c25-11-15-4-1-2-7-20(15)30-17-6-3-5-14(8-17)19-13-26-12-16-9-18(31-22(16)19)10-21-23(28)27-24(29)32-21/h1-10,12-13H,(H,27,28,29)/b21-10- |
| InChIKey | NXAOXUPUYIRHMO-FBHDLOMBSA-N |
| XLogP | 5.48 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|