C22H19N3O4S — CID 118089731
(5E)-5-[[7-[3-(morpholin-4-ylmethyl)phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118089731) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is (5E)-5-[[7-[3-(morpholin-4-ylmethyl)phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[7-[3-(morpholin-4-ylmethyl)phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118089731 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | (5E)-5-[[7-[3-(morpholin-4-ylmethyl)phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2cc3cncc(-c4cccc(CN5CCOCC5)c4)c3o2)S1 |
| InChI | InChI=1S/C22H19N3O4S/c26-21-19(30-22(27)24-21)10-17-9-16-11-23-12-18(20(16)29-17)15-3-1-2-14(8-15)13-25-4-6-28-7-5-25/h1-3,8-12H,4-7,13H2,(H,24,26,27)/b19-10+ |
| InChIKey | WMBFNYDLUQEWCU-VXLYETTFSA-N |
| XLogP | 3.65 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|