C21H16ClN3O6S2 — CID 118089927
(5Z)-5-[[7-(2-chloro-4-morpholin-4-ylsulfonylphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118089927) has the molecular formula C21H16ClN3O6S2 and a molecular weight of 505.96 g/mol. Its IUPAC name is (5Z)-5-[[7-(2-chloro-4-morpholin-4-ylsulfonylphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[7-(2-chloro-4-morpholin-4-ylsulfonylphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118089927 |
| Molecular Formula | C21H16ClN3O6S2 |
| Molecular Weight | 505.96 g/mol |
| Exact Mass | 505.02 |
| IUPAC Name | (5Z)-5-[[7-(2-chloro-4-morpholin-4-ylsulfonylphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cc3cncc(-c4ccc(S(=O)(=O)N5CCOCC5)cc4Cl)c3o2)S1 |
| InChI | InChI=1S/C21H16ClN3O6S2/c22-17-9-14(33(28,29)25-3-5-30-6-4-25)1-2-15(17)16-11-23-10-12-7-13(31-19(12)16)8-18-20(26)24-21(27)32-18/h1-2,7-11H,3-6H2,(H,24,26,27)/b18-8- |
| InChIKey | YPLVWFKKZMTIFU-LSCVHKIXSA-N |
| XLogP | 3.49 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.96 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|