C18H18N4O5S2 — CID 118089518
4-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N,N-dimethyl-3,6-dihydro-2H-pyridine-1-sulfonamide (PubChem CID 118089518) has the molecular formula C18H18N4O5S2 and a molecular weight of 434.50 g/mol. Its IUPAC name is 4-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N,N-dimethyl-3,6-dihydro-2H-pyridine-1-sulfonamide.
| Compound Name | 4-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N,N-dimethyl-3,6-dihydro-2H-pyridine-1-sulfonamide |
|---|---|
| PubChem CID | 118089518 |
| Molecular Formula | C18H18N4O5S2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 4-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N,N-dimethyl-3,6-dihydro-2H-pyridine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CC=C(c2cncc3cc(/C=C4/SC(=O)NC4=O)oc23)CC1 |
| InChI | InChI=1S/C18H18N4O5S2/c1-21(2)29(25,26)22-5-3-11(4-6-22)14-10-19-9-12-7-13(27-16(12)14)8-15-17(23)20-18(24)28-15/h3,7-10H,4-6H2,1-2H3,(H,20,23,24)/b15-8+ |
| InChIKey | OOBQBCLLQNBQPA-OVCLIPMQSA-N |
| XLogP | 2.05 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|