C19H17N3O4S3 — CID 154164698
5-[[7-(1-cyclopropylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 154164698) has the molecular formula C19H17N3O4S3 and a molecular weight of 447.56 g/mol. Its IUPAC name is 5-[[7-(1-cyclopropylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[7-(1-cyclopropylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 154164698 |
| Molecular Formula | C19H17N3O4S3 |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 5-[[7-(1-cyclopropylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)SC1=Cc1cc2cncc(C3=CCN(S(=O)(=O)C4CC4)CC3)c2o1 |
| InChI | InChI=1S/C19H17N3O4S3/c23-18-16(28-19(27)21-18)8-13-7-12-9-20-10-15(17(12)26-13)11-3-5-22(6-4-11)29(24,25)14-1-2-14/h3,7-10,14H,1-2,4-6H2,(H,21,23,27) |
| InChIKey | MVOUBUYEWINYBW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|