C18H8F2N2O4S2 — CID 118090276
(5E)-5-[[7-(2,2-difluoro-1,3-benzodioxol-5-yl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 118090276) has the molecular formula C18H8F2N2O4S2 and a molecular weight of 418.40 g/mol. Its IUPAC name is (5E)-5-[[7-(2,2-difluoro-1,3-benzodioxol-5-yl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[7-(2,2-difluoro-1,3-benzodioxol-5-yl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 118090276 |
| Molecular Formula | C18H8F2N2O4S2 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | (5E)-5-[[7-(2,2-difluoro-1,3-benzodioxol-5-yl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C/c1cc2cncc(-c3ccc4c(c3)OC(F)(F)O4)c2o1 |
| InChI | InChI=1S/C18H8F2N2O4S2/c19-18(20)25-12-2-1-8(4-13(12)26-18)11-7-21-6-9-3-10(24-15(9)11)5-14-16(23)22-17(27)28-14/h1-7H,(H,22,23,27)/b14-5+ |
| InChIKey | NWHGSHDVUFOWHZ-LHHJGKSTSA-N |
| XLogP | 4.31 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|