C18H10F3N3O2S2 — CID 154190586
5-[[7-[4-amino-3-(trifluoromethyl)phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 154190586) has the molecular formula C18H10F3N3O2S2 and a molecular weight of 421.43 g/mol. Its IUPAC name is 5-[[7-[4-amino-3-(trifluoromethyl)phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[7-[4-amino-3-(trifluoromethyl)phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 154190586 |
| Molecular Formula | C18H10F3N3O2S2 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 5-[[7-[4-amino-3-(trifluoromethyl)phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Nc1ccc(-c2cncc3cc(C=C4SC(=S)NC4=O)oc23)cc1C(F)(F)F |
| InChI | InChI=1S/C18H10F3N3O2S2/c19-18(20,21)12-4-8(1-2-13(12)22)11-7-23-6-9-3-10(26-15(9)11)5-14-16(25)24-17(27)28-14/h1-7H,22H2,(H,24,25,27) |
| InChIKey | BIBYTTIKOQAEBF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|