C19H11FN2O4S2 — CID 154170267
methyl 2-fluoro-4-[2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzoate (PubChem CID 154170267) has the molecular formula C19H11FN2O4S2 and a molecular weight of 414.44 g/mol. Its IUPAC name is methyl 2-fluoro-4-[2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzoate.
| Compound Name | methyl 2-fluoro-4-[2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzoate |
|---|---|
| PubChem CID | 154170267 |
| Molecular Formula | C19H11FN2O4S2 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | methyl 2-fluoro-4-[2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cncc3cc(C=C4SC(=S)NC4=O)oc23)cc1F |
| InChI | InChI=1S/C19H11FN2O4S2/c1-25-18(24)12-3-2-9(5-14(12)20)13-8-21-7-10-4-11(26-16(10)13)6-15-17(23)22-19(27)28-15/h2-8H,1H3,(H,22,23,27) |
| InChIKey | INSLJSJFSNQCKK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|