C17H10FN3O3S2 — CID 118089658
(5Z)-5-[[7-(5-fluoro-6-methoxy-3-pyridinyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 118089658) has the molecular formula C17H10FN3O3S2 and a molecular weight of 387.42 g/mol. Its IUPAC name is (5Z)-5-[[7-(5-fluoro-6-methoxy-3-pyridinyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[7-(5-fluoro-6-methoxy-3-pyridinyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 118089658 |
| Molecular Formula | C17H10FN3O3S2 |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | (5Z)-5-[[7-(5-fluoro-6-methoxy-3-pyridinyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ncc(-c2cncc3cc(/C=C4\SC(=S)NC4=O)oc23)cc1F |
| InChI | InChI=1S/C17H10FN3O3S2/c1-23-16-12(18)3-8(6-20-16)11-7-19-5-9-2-10(24-14(9)11)4-13-15(22)21-17(25)26-13/h2-7H,1H3,(H,21,22,25)/b13-4- |
| InChIKey | CIZSGDASWDBERN-PQMHYQBVSA-N |
| XLogP | 3.53 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|