C19H14ClN3O3S2 — CID 154163972
5-[[7-(5-chloro-6-propan-2-yloxy-3-pyridinyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 154163972) has the molecular formula C19H14ClN3O3S2 and a molecular weight of 431.93 g/mol. Its IUPAC name is 5-[[7-(5-chloro-6-propan-2-yloxy-3-pyridinyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[7-(5-chloro-6-propan-2-yloxy-3-pyridinyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 154163972 |
| Molecular Formula | C19H14ClN3O3S2 |
| Molecular Weight | 431.93 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | 5-[[7-(5-chloro-6-propan-2-yloxy-3-pyridinyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(C)Oc1ncc(-c2cncc3cc(C=C4SC(=S)NC4=O)oc23)cc1Cl |
| InChI | InChI=1S/C19H14ClN3O3S2/c1-9(2)25-18-14(20)4-10(7-22-18)13-8-21-6-11-3-12(26-16(11)13)5-15-17(24)23-19(27)28-15/h3-9H,1-2H3,(H,23,24,27) |
| InChIKey | KNGVMHROKCPAOP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.93 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|