C18H8F4N2O2S2 — CID 118090388
(5Z)-5-[[7-[4-fluoro-3-(trifluoromethyl)phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 118090388) has the molecular formula C18H8F4N2O2S2 and a molecular weight of 424.40 g/mol. Its IUPAC name is (5Z)-5-[[7-[4-fluoro-3-(trifluoromethyl)phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[7-[4-fluoro-3-(trifluoromethyl)phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 118090388 |
| Molecular Formula | C18H8F4N2O2S2 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | (5Z)-5-[[7-[4-fluoro-3-(trifluoromethyl)phenyl]furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C\c1cc2cncc(-c3ccc(F)c(C(F)(F)F)c3)c2o1 |
| InChI | InChI=1S/C18H8F4N2O2S2/c19-13-2-1-8(4-12(13)18(20,21)22)11-7-23-6-9-3-10(26-15(9)11)5-14-16(25)24-17(27)28-14/h1-7H,(H,24,25,27)/b14-5- |
| InChIKey | KSOGVDMRCSPZIC-RZNTYIFUSA-N |
| XLogP | 5.14 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|