C19H12N2O5S — CID 118090608
(5Z)-5-[[7-(4H-1,3-benzodioxin-6-yl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118090608) has the molecular formula C19H12N2O5S and a molecular weight of 380.38 g/mol. Its IUPAC name is (5Z)-5-[[7-(4H-1,3-benzodioxin-6-yl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[7-(4H-1,3-benzodioxin-6-yl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118090608 |
| Molecular Formula | C19H12N2O5S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | (5Z)-5-[[7-(4H-1,3-benzodioxin-6-yl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cc3cncc(-c4ccc5c(c4)COCO5)c3o2)S1 |
| InChI | InChI=1S/C19H12N2O5S/c22-18-16(27-19(23)21-18)5-13-4-11-6-20-7-14(17(11)26-13)10-1-2-15-12(3-10)8-24-9-25-15/h1-7H,8-9H2,(H,21,22,23)/b16-5- |
| InChIKey | YXXODOXFOXOTBI-BNCCVWRVSA-N |
| XLogP | 3.69 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|