C26H21F2N5O3S — CID 59635596
(5E)-5-[[4-fluoro-3-[6-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]pyrazin-2-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 59635596) has the molecular formula C26H21F2N5O3S and a molecular weight of 521.55 g/mol. Its IUPAC name is (5E)-5-[[4-fluoro-3-[6-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]pyrazin-2-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-fluoro-3-[6-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]pyrazin-2-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 59635596 |
| Molecular Formula | C26H21F2N5O3S |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | (5E)-5-[[4-fluoro-3-[6-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]pyrazin-2-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccc(F)c(-c3cncc(N4CCCN(C(=O)c5ccccc5F)CC4)n3)c2)S1 |
| InChI | InChI=1S/C26H21F2N5O3S/c27-19-5-2-1-4-17(19)25(35)33-9-3-8-32(10-11-33)23-15-29-14-21(30-23)18-12-16(6-7-20(18)28)13-22-24(34)31-26(36)37-22/h1-2,4-7,12-15H,3,8-11H2,(H,31,34,36)/b22-13+ |
| InChIKey | WTGXUVBRFPJQOL-LPYMAVHISA-N |
| XLogP | 4.10 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|