C19H22FN5O — CID 7292349
(2-fluorophenyl)-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)piperazin-1-yl]methanone (PubChem CID 7292349) has the molecular formula C19H22FN5O and a molecular weight of 355.42 g/mol. Its IUPAC name is (2-fluorophenyl)-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)piperazin-1-yl]methanone.
| Compound Name | (2-fluorophenyl)-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 7292349 |
| Molecular Formula | C19H22FN5O |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (2-fluorophenyl)-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccccc1F)N1CCN(c2ccc(N3CCCC3)nn2)CC1 |
| InChI | InChI=1S/C19H22FN5O/c20-16-6-2-1-5-15(16)19(26)25-13-11-24(12-14-25)18-8-7-17(21-22-18)23-9-3-4-10-23/h1-2,5-8H,3-4,9-14H2 |
| InChIKey | GIFZBGCQVJJRAP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |