C24H27N5O — CID 121053800
naphthalen-1-yl-[4-(6-piperidin-1-ylpyridazin-3-yl)piperazin-1-yl]methanone (PubChem CID 121053800) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is naphthalen-1-yl-[4-(6-piperidin-1-ylpyridazin-3-yl)piperazin-1-yl]methanone.
| Compound Name | naphthalen-1-yl-[4-(6-piperidin-1-ylpyridazin-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 121053800 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | naphthalen-1-yl-[4-(6-piperidin-1-ylpyridazin-3-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc2ccccc12)N1CCN(c2ccc(N3CCCCC3)nn2)CC1 |
| InChI | InChI=1S/C24H27N5O/c30-24(21-10-6-8-19-7-2-3-9-20(19)21)29-17-15-28(16-18-29)23-12-11-22(25-26-23)27-13-4-1-5-14-27/h2-3,6-12H,1,4-5,13-18H2 |
| InChIKey | YIFFVTHNFUNCMQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |