C26H28N4O3 — CID 5174506
naphthalen-1-yl-[4-(4-nitro-3-piperidin-1-ylphenyl)piperazin-1-yl]methanone (PubChem CID 5174506) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is naphthalen-1-yl-[4-(4-nitro-3-piperidin-1-ylphenyl)piperazin-1-yl]methanone.
| Compound Name | naphthalen-1-yl-[4-(4-nitro-3-piperidin-1-ylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 5174506 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | naphthalen-1-yl-[4-(4-nitro-3-piperidin-1-ylphenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc2ccccc12)N1CCN(c2ccc([N+](=O)[O-])c(N3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C26H28N4O3/c31-26(23-10-6-8-20-7-2-3-9-22(20)23)29-17-15-27(16-18-29)21-11-12-24(30(32)33)25(19-21)28-13-4-1-5-14-28/h2-3,6-12,19H,1,4-5,13-18H2 |
| InChIKey | DQMJQIMYIKHKIM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|