C22H20N4O4 — CID 25337134
4-[4-(naphthalene-1-carbonyl)piperazin-1-yl]-3-nitrobenzamide (PubChem CID 25337134) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 4-[4-(naphthalene-1-carbonyl)piperazin-1-yl]-3-nitrobenzamide.
| Compound Name | 4-[4-(naphthalene-1-carbonyl)piperazin-1-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 25337134 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-[4-(naphthalene-1-carbonyl)piperazin-1-yl]-3-nitrobenzamide |
| SMILES | NC(=O)c1ccc(N2CCN(C(=O)c3cccc4ccccc34)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H20N4O4/c23-21(27)16-8-9-19(20(14-16)26(29)30)24-10-12-25(13-11-24)22(28)18-7-3-5-15-4-1-2-6-17(15)18/h1-9,14H,10-13H2,(H2,23,27) |
| InChIKey | CSWVDVSQFPOXHR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|