C18H17F3N4O3 — CID 3604633
3-nitro-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]benzamide (PubChem CID 3604633) has the molecular formula C18H17F3N4O3 and a molecular weight of 394.35 g/mol. Its IUPAC name is 3-nitro-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]benzamide.
| Compound Name | 3-nitro-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 3604633 |
| Molecular Formula | C18H17F3N4O3 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 3-nitro-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]benzamide |
| SMILES | NC(=O)c1ccc(N2CCN(c3cccc(C(F)(F)F)c3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17F3N4O3/c19-18(20,21)13-2-1-3-14(11-13)23-6-8-24(9-7-23)15-5-4-12(17(22)26)10-16(15)25(27)28/h1-5,10-11H,6-9H2,(H2,22,26) |
| InChIKey | LIFKXBODIKEQDV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|