C17H17F3N4O4S — CID 4841617
3-nitro-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]benzenesulfonamide (PubChem CID 4841617) has the molecular formula C17H17F3N4O4S and a molecular weight of 430.41 g/mol. Its IUPAC name is 3-nitro-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]benzenesulfonamide.
| Compound Name | 3-nitro-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 4841617 |
| Molecular Formula | C17H17F3N4O4S |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 3-nitro-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2CCN(c3cccc(C(F)(F)F)c3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17F3N4O4S/c18-17(19,20)12-2-1-3-13(10-12)22-6-8-23(9-7-22)15-5-4-14(29(21,27)28)11-16(15)24(25)26/h1-5,10-11H,6-9H2,(H2,21,27,28) |
| InChIKey | ZXMFLPPCCSELBO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|