C24H25ClN4O3S — CID 2968044
(3-chloro-1-benzothiophen-2-yl)-[4-(4-nitro-3-piperidin-1-ylphenyl)piperazin-1-yl]methanone (PubChem CID 2968044) has the molecular formula C24H25ClN4O3S and a molecular weight of 485.01 g/mol. Its IUPAC name is (3-chloro-1-benzothiophen-2-yl)-[4-(4-nitro-3-piperidin-1-ylphenyl)piperazin-1-yl]methanone.
| Compound Name | (3-chloro-1-benzothiophen-2-yl)-[4-(4-nitro-3-piperidin-1-ylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 2968044 |
| Molecular Formula | C24H25ClN4O3S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | (3-chloro-1-benzothiophen-2-yl)-[4-(4-nitro-3-piperidin-1-ylphenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1sc2ccccc2c1Cl)N1CCN(c2ccc([N+](=O)[O-])c(N3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C24H25ClN4O3S/c25-22-18-6-2-3-7-21(18)33-23(22)24(30)28-14-12-26(13-15-28)17-8-9-19(29(31)32)20(16-17)27-10-4-1-5-11-27/h2-3,6-9,16H,1,4-5,10-15H2 |
| InChIKey | HHXUQESJRMARQL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|