C19H21FN4O3S — CID 166792027
(5-fluorothiophen-2-yl)-[4-(4-nitro-3-pyrrolidin-1-ylphenyl)piperazin-1-yl]methanone (PubChem CID 166792027) has the molecular formula C19H21FN4O3S and a molecular weight of 404.47 g/mol. Its IUPAC name is (5-fluorothiophen-2-yl)-[4-(4-nitro-3-pyrrolidin-1-ylphenyl)piperazin-1-yl]methanone.
| Compound Name | (5-fluorothiophen-2-yl)-[4-(4-nitro-3-pyrrolidin-1-ylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 166792027 |
| Molecular Formula | C19H21FN4O3S |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (5-fluorothiophen-2-yl)-[4-(4-nitro-3-pyrrolidin-1-ylphenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)s1)N1CCN(c2ccc([N+](=O)[O-])c(N3CCCC3)c2)CC1 |
| InChI | InChI=1S/C19H21FN4O3S/c20-18-6-5-17(28-18)19(25)23-11-9-21(10-12-23)14-3-4-15(24(26)27)16(13-14)22-7-1-2-8-22/h3-6,13H,1-2,7-12H2 |
| InChIKey | ZHIFMVUURFRXOB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|