C20H15N3O2S2 — CID 25211849
(5E)-5-[[4-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 25211849) has the molecular formula C20H15N3O2S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is (5E)-5-[[4-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 25211849 |
| Molecular Formula | C20H15N3O2S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (5E)-5-[[4-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccc3nccc(-c4cc5c(s4)CCNC5)c3c2)S1 |
| InChI | InChI=1S/C20H15N3O2S2/c24-19-18(27-20(25)23-19)8-11-1-2-15-14(7-11)13(3-6-22-15)17-9-12-10-21-5-4-16(12)26-17/h1-3,6-9,21H,4-5,10H2,(H,23,24,25)/b18-8+ |
| InChIKey | SYOCTZROHPWIEL-QGMBQPNBSA-N |
| XLogP | 3.93 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|