C25H18N2O4S2 — CID 25211749
(5Z)-5-[[4-[5-(2,6-dimethoxyphenyl)thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 25211749) has the molecular formula C25H18N2O4S2 and a molecular weight of 474.56 g/mol. Its IUPAC name is (5Z)-5-[[4-[5-(2,6-dimethoxyphenyl)thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[5-(2,6-dimethoxyphenyl)thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 25211749 |
| Molecular Formula | C25H18N2O4S2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | (5Z)-5-[[4-[5-(2,6-dimethoxyphenyl)thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cccc(OC)c1-c1ccc(-c2ccnc3ccc(/C=C4\SC(=O)NC4=O)cc23)s1 |
| InChI | InChI=1S/C25H18N2O4S2/c1-30-18-4-3-5-19(31-2)23(18)21-9-8-20(32-21)15-10-11-26-17-7-6-14(12-16(15)17)13-22-24(28)27-25(29)33-22/h3-13H,1-2H3,(H,27,28,29)/b22-13- |
| InChIKey | AYBHCJMXTMHCCP-XKZIYDEJSA-N |
| XLogP | 5.97 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|