C27H23N3O4S3 — CID 87633925
N-butyl-3-[5-[6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]thiophen-2-yl]benzenesulfonamide (PubChem CID 87633925) has the molecular formula C27H23N3O4S3 and a molecular weight of 549.70 g/mol. Its IUPAC name is N-butyl-3-[5-[6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]thiophen-2-yl]benzenesulfonamide.
| Compound Name | N-butyl-3-[5-[6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]thiophen-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 87633925 |
| Molecular Formula | C27H23N3O4S3 |
| Molecular Weight | 549.70 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | N-butyl-3-[5-[6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]thiophen-2-yl]benzenesulfonamide |
| SMILES | CCCCNS(=O)(=O)c1cccc(-c2ccc(-c3ccnc4ccc(C=C5SC(=O)NC5=O)cc34)s2)c1 |
| InChI | InChI=1S/C27H23N3O4S3/c1-2-3-12-29-37(33,34)19-6-4-5-18(16-19)23-9-10-24(35-23)20-11-13-28-22-8-7-17(14-21(20)22)15-25-26(31)30-27(32)36-25/h4-11,13-16,29H,2-3,12H2,1H3,(H,30,31,32) |
| InChIKey | PQJPIRNZAAETSA-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.70 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|