C26H20N2O3S2 — CID 25211748
(5E)-5-[[4-[5-(3-propan-2-yloxyphenyl)thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 25211748) has the molecular formula C26H20N2O3S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is (5E)-5-[[4-[5-(3-propan-2-yloxyphenyl)thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[5-(3-propan-2-yloxyphenyl)thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 25211748 |
| Molecular Formula | C26H20N2O3S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | (5E)-5-[[4-[5-(3-propan-2-yloxyphenyl)thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)Oc1cccc(-c2ccc(-c3ccnc4ccc(/C=C5/SC(=O)NC5=O)cc34)s2)c1 |
| InChI | InChI=1S/C26H20N2O3S2/c1-15(2)31-18-5-3-4-17(14-18)22-8-9-23(32-22)19-10-11-27-21-7-6-16(12-20(19)21)13-24-25(29)28-26(30)33-24/h3-15H,1-2H3,(H,28,29,30)/b24-13+ |
| InChIKey | MCEWPPORWQCMOB-ZMOGYAJESA-N |
| XLogP | 6.74 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|