C13H11NO5S — CID 43829040
2-[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]propanoic acid (PubChem CID 43829040) has the molecular formula C13H11NO5S and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]propanoic acid.
| Compound Name | 2-[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 43829040 |
| Molecular Formula | C13H11NO5S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]propanoic acid |
| SMILES | CC(Oc1cccc(/C=C2/SC(=O)NC2=O)c1)C(=O)O |
| InChI | InChI=1S/C13H11NO5S/c1-7(12(16)17)19-9-4-2-3-8(5-9)6-10-11(15)14-13(18)20-10/h2-7H,1H3,(H,16,17)(H,14,15,18)/b10-6+ |
| InChIKey | SIJVZOXBEUQXSJ-UXBLZVDNSA-N |
| XLogP | 1.86 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|